CAS 53379-61-6 is the registry number for 1-(4-BROMO-3,5-DIMETHYLPHENYL)ETHANONE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
1-(4-bromo-3,5-dimethylphenyl)ethanone (CAS 53379-61-6) is a chemical compound with the molecular formula C10H11BrO and a molecular weight of 227.10 g/mol. IUPAC name: 1-(4-bromo-3,5-dimethylphenyl)ethanone. InChIKey: OBFZMOLOQFKVRW-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO |
|---|---|
| Molecular weight | 227.10 g/mol |
| IUPAC name | 1-(4-bromo-3,5-dimethylphenyl)ethanone |
| InChIKey | OBFZMOLOQFKVRW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1Br)C)C(=O)C |
Computed by PubChem (NCBI)