Products 533884-08-1
CAS 533884-08-1 appears in our catalog under these names: Serba-2/ 100%, (-)-Erteberel, 99.85%, Serba-2. Offered by: TargetMol, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 1 mg, 5 mg, 25mg.
(3aR,4S,9bS)-4-(4-hydroxyphenyl)-1,2,3,3a,4,9b-hexahydrocyclopenta[c]chromen-8-ol (CAS 533884-08-1) is a chemical compound with the molecular formula C18H18O3 and a molecular weight of 282.3 g/mol. IUPAC name: (3aR,4S,9bS)-4-(4-hydroxyphenyl)-1,2,3,3a,4,9b-hexahydrocyclopenta[c]chromen-8-ol. InChIKey: XIESSJVMWNJCGZ-HDMKZQKVSA-N.
| Molecular formula | C18H18O3 |
|---|---|
| Molecular weight | 282.3 g/mol |
| IUPAC name | (3aR,4S,9bS)-4-(4-hydroxyphenyl)-1,2,3,3a,4,9b-hexahydrocyclopenta[c]chromen-8-ol |
| InChIKey | XIESSJVMWNJCGZ-HDMKZQKVSA-N |
| SMILES | C1C[C@@H]2[C@H](C1)C3=C(C=CC(=C3)O)O[C@@H]2C4=CC=C(C=C4)O |
Computed by PubChem (NCBI)