Products 75335-47-6
CAS 75335-47-6 is the registry number for (E)-4-(4-Benzyloxy-3-methoxyphenyl)-but-3-en-2-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
(E)-4-(3-methoxy-4-phenylmethoxyphenyl)but-3-en-2-one (CAS 75335-47-6) is a chemical compound with the molecular formula C18H18O3 and a molecular weight of 282.3 g/mol. IUPAC name: (E)-4-(3-methoxy-4-phenylmethoxyphenyl)but-3-en-2-one. InChIKey: PBIKLALBZAUAAP-CMDGGOBGSA-N.
| Molecular formula | C18H18O3 |
|---|---|
| Molecular weight | 282.3 g/mol |
| IUPAC name | (E)-4-(3-methoxy-4-phenylmethoxyphenyl)but-3-en-2-one |
| InChIKey | PBIKLALBZAUAAP-CMDGGOBGSA-N |
| SMILES | CC(=O)/C=C/C1=CC(=C(C=C1)OCC2=CC=CC=C2)OC |
Computed by PubChem (NCBI)