CAS 534-51-0 is the registry number for 2-Amino-3-(4-(4-hydroxyphenoxy)-3,5-diiodophenyl)propanoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3,5-Diiodothyronine is an organonitrogen compound and an organooxygen compound. It is functionally related to an alpha-amino acid.
Source: ChEBI
| Molecular formula | C15H13I2NO4 |
|---|---|
| Molecular weight | 525.08 g/mol |
| IUPAC name | 2-amino-3-[4-(4-hydroxyphenoxy)-3,5-diiodophenyl]propanoic acid |
| InChIKey | ZHSOTLOTTDYIIK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1O)OC2=C(C=C(C=C2I)CC(C(=O)O)N)I |
Computed by PubChem (NCBI)