CAS 5563-89-3 is the registry number for Levothyroxine Impurity 19. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
(2R)-2-amino-3-[4-(4-hydroxyphenoxy)-3,5-diiodophenyl]propanoic acid (CAS 5563-89-3) is a chemical compound with the molecular formula C15H13I2NO4 and a molecular weight of 525.08 g/mol. IUPAC name: (2R)-2-amino-3-[4-(4-hydroxyphenoxy)-3,5-diiodophenyl]propanoic acid. InChIKey: ZHSOTLOTTDYIIK-CYBMUJFWSA-N.
| Molecular formula | C15H13I2NO4 |
|---|---|
| Molecular weight | 525.08 g/mol |
| IUPAC name | (2R)-2-amino-3-[4-(4-hydroxyphenoxy)-3,5-diiodophenyl]propanoic acid |
| InChIKey | ZHSOTLOTTDYIIK-CYBMUJFWSA-N |
| SMILES | C1=CC(=CC=C1O)OC2=C(C=C(C=C2I)C[C@H](C(=O)O)N)I |
Computed by PubChem (NCBI)