Products 5563-89-3

CAS 5563-89-3 is the registry number for Levothyroxine Impurity 19. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

(2R)-2-amino-3-[4-(4-hydroxyphenoxy)-3,5-diiodophenyl]propanoic acid (CAS 5563-89-3) is a chemical compound with the molecular formula C15H13I2NO4 and a molecular weight of 525.08 g/mol. IUPAC name: (2R)-2-amino-3-[4-(4-hydroxyphenoxy)-3,5-diiodophenyl]propanoic acid. InChIKey: ZHSOTLOTTDYIIK-CYBMUJFWSA-N.

Identity
Molecular formulaC15H13I2NO4
Molecular weight525.08 g/mol
IUPAC name(2R)-2-amino-3-[4-(4-hydroxyphenoxy)-3,5-diiodophenyl]propanoic acid
InChIKeyZHSOTLOTTDYIIK-CYBMUJFWSA-N
SMILESC1=CC(=CC=C1O)OC2=C(C=C(C=C2I)C[C@H](C(=O)O)N)I

Computed by PubChem (NCBI)