CAS 53400-60-5 appears in our catalog under these names: 5,6,7,8-Tetrahydroquinoline-8-carbothioamide, 97%, 5,6,7,8-Tetrahydro-8-quinolinecarbothioamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5,6,7,8-tetrahydroquinoline-8-carbothioamide (CAS 53400-60-5) is a chemical compound with the molecular formula C10H12N2S and a molecular weight of 192.28 g/mol. IUPAC name: 5,6,7,8-tetrahydroquinoline-8-carbothioamide. InChIKey: MUZLJLSOGBHBDC-UHFFFAOYSA-N.
| Molecular formula | C10H12N2S |
|---|---|
| Molecular weight | 192.28 g/mol |
| IUPAC name | 5,6,7,8-tetrahydroquinoline-8-carbothioamide |
| InChIKey | MUZLJLSOGBHBDC-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C=CC=N2)C(=S)N |
Computed by PubChem (NCBI)