CAS 534572-20-8 is the registry number for (3R,5S)-1-tert-butoxycarbonyl-5-methoxycarbonyl-piperidine-3-carboxylic acid, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(3R,5S)-5-methoxycarbonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid (CAS 534572-20-8) is a chemical compound with the molecular formula C13H21NO6 and a molecular weight of 287.31 g/mol. IUPAC name: (3R,5S)-5-methoxycarbonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid. InChIKey: DYLHJFCOKNLATM-BDAKNGLRSA-N.
| Molecular formula | C13H21NO6 |
|---|---|
| Molecular weight | 287.31 g/mol |
| IUPAC name | (3R,5S)-5-methoxycarbonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid |
| InChIKey | DYLHJFCOKNLATM-BDAKNGLRSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@@H](C1)C(=O)OC)C(=O)O |
Computed by PubChem (NCBI)