CAS 914261-00-0 is the registry number for trans-1-Boc-5-(methoxycarbonyl)piperidine-3-carboxylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(3S,5S)-5-methoxycarbonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid (CAS 914261-00-0) is a chemical compound with the molecular formula C13H21NO6 and a molecular weight of 287.31 g/mol. IUPAC name: (3S,5S)-5-methoxycarbonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid. InChIKey: DYLHJFCOKNLATM-IUCAKERBSA-N.
| Molecular formula | C13H21NO6 |
|---|---|
| Molecular weight | 287.31 g/mol |
| IUPAC name | (3S,5S)-5-methoxycarbonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid |
| InChIKey | DYLHJFCOKNLATM-IUCAKERBSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@@H](C1)C(=O)OC)C(=O)O |
Computed by PubChem (NCBI)