Products 53484-73-4
CAS 53484-73-4 appears in our catalog under these names: Meperidine-d4 (Pethidine-d4), Meperidine-d4, Pethidine-D4 (Meperidine-D4) 0.1 mg/ml in Methanol, Pethidine-D4 (Meperidine-D4) 1.0 mg/ml in Methanol. Offered by: Chemat Brand, TRC, LoGiCal. Available pack sizes: on request, 50mg, 1ml.
Ethyl 3,3,5,5-tetradeuterio-1-methyl-4-phenylpiperidine-4-carboxylate (CAS 53484-73-4) is a chemical compound with the molecular formula C15H21NO2 and a molecular weight of 251.36 g/mol. IUPAC name: ethyl 3,3,5,5-tetradeuterio-1-methyl-4-phenylpiperidine-4-carboxylate. InChIKey: XADCESSVHJOZHK-YQUBHJMPSA-N.
| Molecular formula | C15H21NO2 |
|---|---|
| Molecular weight | 251.36 g/mol |
| IUPAC name | ethyl 3,3,5,5-tetradeuterio-1-methyl-4-phenylpiperidine-4-carboxylate |
| InChIKey | XADCESSVHJOZHK-YQUBHJMPSA-N |
| SMILES | [2H]C1(CN(CC(C1(C2=CC=CC=C2)C(=O)OCC)([2H])[2H])C)[2H] |
Computed by PubChem (NCBI)