Products 535-53-5
CAS 535-53-5 appears in our catalog under these names: Cinacalcet Impurity 80, 3-(3-(trifluoromethyl)phenyl)propanamide. Offered by: Hubei YoungXin, Chemat Brand. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request.
3-[3-(trifluoromethyl)phenyl]propanamide (CAS 535-53-5) is a chemical compound with the molecular formula C10H10F3NO and a molecular weight of 217.19 g/mol. IUPAC name: 3-[3-(trifluoromethyl)phenyl]propanamide. InChIKey: VWPGYZUOKQXPRA-UHFFFAOYSA-N.
| Molecular formula | C10H10F3NO |
|---|---|
| Molecular weight | 217.19 g/mol |
| IUPAC name | 3-[3-(trifluoromethyl)phenyl]propanamide |
| InChIKey | VWPGYZUOKQXPRA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)CCC(=O)N |
Computed by PubChem (NCBI)