CAS 5351-07-5 appears in our catalog under these names: 2-(4-Methoxyphenyl)-2-methylpropanenitrile, 95%, 2–(4–Methoxyphenyl)–2–methylpropanenitrile. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g.
2-(4-methoxyphenyl)-2-methylpropanenitrile (CAS 5351-07-5) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: 2-(4-methoxyphenyl)-2-methylpropanenitrile. InChIKey: CDCRUVGWQJYTFO-UHFFFAOYSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-2-methylpropanenitrile |
| InChIKey | CDCRUVGWQJYTFO-UHFFFAOYSA-N |
| SMILES | CC(C)(C#N)C1=CC=C(C=C1)OC |
Computed by PubChem (NCBI)