CAS 5351-24-6 appears in our catalog under these names: 4-Isopropyl-benzoic acid hydrazide, 95%, 4-Isopropylbenzohydrazide, 90%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
4-propan-2-ylbenzohydrazide (CAS 5351-24-6) is a chemical compound with the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. IUPAC name: 4-propan-2-ylbenzohydrazide. InChIKey: ZRVXDEFJKAAGGH-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 4-propan-2-ylbenzohydrazide |
| InChIKey | ZRVXDEFJKAAGGH-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C(=O)NN |
Computed by PubChem (NCBI)