Products 53544-81-3
CAS 53544-81-3 is the registry number for 2-(3-Amino-phenyl)-benzothiazol-6-ylamine, 98%. Offered by: Fluorochem. Available pack sizes: 1g.
2-(3-aminophenyl)-1,3-benzothiazol-6-amine (CAS 53544-81-3) is a chemical compound with the molecular formula C13H11N3S and a molecular weight of 241.31 g/mol. IUPAC name: 2-(3-aminophenyl)-1,3-benzothiazol-6-amine. InChIKey: KYIGQQDOCAWDFB-UHFFFAOYSA-N.
| Molecular formula | C13H11N3S |
|---|---|
| Molecular weight | 241.31 g/mol |
| IUPAC name | 2-(3-aminophenyl)-1,3-benzothiazol-6-amine |
| InChIKey | KYIGQQDOCAWDFB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=NC3=C(S2)C=C(C=C3)N |
Computed by PubChem (NCBI)