Products 53587-11-4
CAS 53587-11-4 appears in our catalog under these names: L-Tyrosine Benzyl Ester 4-Toluenesulfonate, L-Tyrosine benzyl ester tosylate, 98%, H–Tyr–OBzl?TosOH, H-L-Tyr-OBzl*Tos, L-Tyrosine Benzyl Ester p-Toluenesulfonate, >98.0%(HPLC)(T). Offered by: TRC, Combi-blocks, GLPBio, Iris Biotech, TCI. Available pack sizes: 100mg, 500mg, 50mg, 100g, 1kg, 25g, 500g, 5g.
Benzyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate;4-methylbenzenesulfonic acid (CAS 53587-11-4) is a chemical compound with the molecular formula C23H25NO6S and a molecular weight of 443.5 g/mol. IUPAC name: benzyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate;4-methylbenzenesulfonic acid. InChIKey: PJGVHBLZZQDFFM-RSAXXLAASA-N.
| Molecular formula | C23H25NO6S |
|---|---|
| Molecular weight | 443.5 g/mol |
| IUPAC name | benzyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate;4-methylbenzenesulfonic acid |
| InChIKey | PJGVHBLZZQDFFM-RSAXXLAASA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C1=CC=C(C=C1)COC(=O)[C@H](CC2=CC=C(C=C2)O)N |
Computed by PubChem (NCBI)
Synonyms:
O-Benzyl-L-tyrosine toluene-p-sulphonate, H-Tyr-OBzl.TosOH, L-Tyrosine benzyl ester tosylate, L-Tyrosine Benzyl Ester p-Toluenesulfonate, L-Tyrosine benzyl ester p-toluenesulfonate salt, benzyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate;4-methylbenzenesulfonic acid, L-Tyrosine, phenylmethyl ester, 4-methylbenzenesulfonate (salt), L-Tyrosine Benzyl Ester p-Methylbenzenesulfonate, L-Tyrosine benzyl ester 4-toluenesulfonate, H-Tyr-OBzl TosOH