CAS 97984-63-9 appears in our catalog under these names: H-D-Tyr-OBzl·TosOH, 95%, H–D–Tyr–OBzl · p–tosylate, (R)-Benzyl 2-amino-3-(4-hydroxyphenyl)propanoate 4-methylbenzenesulfonate, 95%, 95%. Offered by: AmBeed, GLPBio, Chemat. Available pack sizes: 5g, 1g, 25g, 10g.
Benzyl 2-amino-3-(4-hydroxyphenyl)propanoate;4-methylbenzenesulfonic acid (CAS 97984-63-9) is a chemical compound with the molecular formula C23H25NO6S and a molecular weight of 443.5 g/mol. IUPAC name: benzyl 2-amino-3-(4-hydroxyphenyl)propanoate;4-methylbenzenesulfonic acid. InChIKey: PJGVHBLZZQDFFM-UHFFFAOYSA-N.
| Molecular formula | C23H25NO6S |
|---|---|
| Molecular weight | 443.5 g/mol |
| IUPAC name | benzyl 2-amino-3-(4-hydroxyphenyl)propanoate;4-methylbenzenesulfonic acid |
| InChIKey | PJGVHBLZZQDFFM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C1=CC=C(C=C1)COC(=O)C(CC2=CC=C(C=C2)O)N |
Computed by PubChem (NCBI)