CAS 53606-06-7 appears in our catalog under these names: 4–(Methylsulfonyl)benzyl bromide, 4-(Methylsulfonyl)benzyl Bromide, >97.0%(GC)(T), 4-Methylsulphonylbenzyl bromide, tech., 1-(Bromomethyl)-4-(methylsulfonyl)benzene 98%, 4-(Methylsulfonyl)benzyl Bromide, 98%, 98%. Offered by: GLPBio, TCI, Thermo Scientific (Acros), Ambeed, Chemat. Available pack sizes: 100g, 25g, 5g, 1g, 2.5g, 10g, 500g.
1-(bromomethyl)-4-methylsulfonylbenzene (CAS 53606-06-7) is a chemical compound with the molecular formula C8H9BrO2S and a molecular weight of 249.13 g/mol. IUPAC name: 1-(bromomethyl)-4-methylsulfonylbenzene. InChIKey: HGKPAXHJTMHWAH-UHFFFAOYSA-N.
| Molecular formula | C8H9BrO2S |
|---|---|
| Molecular weight | 249.13 g/mol |
| IUPAC name | 1-(bromomethyl)-4-methylsulfonylbenzene |
| InChIKey | HGKPAXHJTMHWAH-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)CBr |
Computed by PubChem (NCBI)