CAS 53622-33-6 is the registry number for 2-Bromo-phenanthrene-9,10-dione. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-bromophenanthrene-9,10-dione (CAS 53622-33-6) is a chemical compound with the molecular formula C14H7BrO2 and a molecular weight of 287.11 g/mol. IUPAC name: 2-bromophenanthrene-9,10-dione. InChIKey: DSHTXZUCUCBRAF-UHFFFAOYSA-N.
| Molecular formula | C14H7BrO2 |
|---|---|
| Molecular weight | 287.11 g/mol |
| IUPAC name | 2-bromophenanthrene-9,10-dione |
| InChIKey | DSHTXZUCUCBRAF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C=C(C=C3)Br)C(=O)C2=O |
Computed by PubChem (NCBI)