CAS 632-83-7 appears in our catalog under these names: 1-Bromoanthraquinone, 97%, 1–Bromoanthraquinone, 1-Bromoanthraquinone, >95.0%(GC), 1-Bromoanthracene-9,10-dione, 95.0%, 95.0%, 1-BROMOANTHRAQUINONE. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 25g, 5g, 1g.
1-bromoanthracene-9,10-dione (CAS 632-83-7) is a chemical compound with the molecular formula C14H7BrO2 and a molecular weight of 287.11 g/mol. IUPAC name: 1-bromoanthracene-9,10-dione. InChIKey: CXTPIHZYOGDSLV-UHFFFAOYSA-N.
| Molecular formula | C14H7BrO2 |
|---|---|
| Molecular weight | 287.11 g/mol |
| IUPAC name | 1-bromoanthracene-9,10-dione |
| InChIKey | CXTPIHZYOGDSLV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C(=CC=C3)Br |
Computed by PubChem (NCBI)