CAS 5363-53-1 appears in our catalog under these names: N-Ethyl-N-(3-sulfobenzyl)sulfanilic Acid Disodium Salt (>90%), >95% (HPLC), 3-((Ethyl(4-sulfophenyl)amino)methyl)benzenesulfonic acid, 98%, N-Ethyl-N-(3-sulfobenzyl)sulfanilic acid disodium, 3-[[Ethyl(4-sulfophenyl)amino]methyl]benzenesulfonic acid, 95%+, 95%+. Offered by: TRC, AmBeed, Biosynth, Chemat. Available pack sizes: 50mg, 5mg, 25mg, 10mg.
3-[(N-ethyl-4-sulfoanilino)methyl]benzenesulfonic acid (CAS 5363-53-1) is a chemical compound with the molecular formula C15H17NO6S2 and a molecular weight of 371.4 g/mol. IUPAC name: 3-[(N-ethyl-4-sulfoanilino)methyl]benzenesulfonic acid. InChIKey: AYCUIMULGJGRRZ-UHFFFAOYSA-N.
| Molecular formula | C15H17NO6S2 |
|---|---|
| Molecular weight | 371.4 g/mol |
| IUPAC name | 3-[(N-ethyl-4-sulfoanilino)methyl]benzenesulfonic acid |
| InChIKey | AYCUIMULGJGRRZ-UHFFFAOYSA-N |
| SMILES | CCN(CC1=CC(=CC=C1)S(=O)(=O)O)C2=CC=C(C=C2)S(=O)(=O)O |
Computed by PubChem (NCBI)