CAS 6268-04-8 is the registry number for 3-(Ethyl((4-sulfophenyl)methyl)amino)benzenesulfonic Acid. Offered by: TRC. Available pack sizes: 250mg.
3-[ethyl-[(4-sulfophenyl)methyl]amino]benzenesulfonic acid (CAS 6268-04-8) is a chemical compound with the molecular formula C15H17NO6S2 and a molecular weight of 371.4 g/mol. IUPAC name: 3-[ethyl-[(4-sulfophenyl)methyl]amino]benzenesulfonic acid. InChIKey: IUEFIBDFHWQRQJ-UHFFFAOYSA-N.
| Molecular formula | C15H17NO6S2 |
|---|---|
| Molecular weight | 371.4 g/mol |
| IUPAC name | 3-[ethyl-[(4-sulfophenyl)methyl]amino]benzenesulfonic acid |
| InChIKey | IUEFIBDFHWQRQJ-UHFFFAOYSA-N |
| SMILES | CCN(CC1=CC=C(C=C1)S(=O)(=O)O)C2=CC(=CC=C2)S(=O)(=O)O |
Computed by PubChem (NCBI)