CAS 536723-94-1 is the registry number for 4'-Ethoxy-2'-hydroxy-3'-methylacetophenone, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-(4-ethoxy-2-hydroxy-3-methylphenyl)ethanone (CAS 536723-94-1) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: 1-(4-ethoxy-2-hydroxy-3-methylphenyl)ethanone. InChIKey: JZJNFRYRYWLJBP-UHFFFAOYSA-N.
| Molecular formula | C11H14O3 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 1-(4-ethoxy-2-hydroxy-3-methylphenyl)ethanone |
| InChIKey | JZJNFRYRYWLJBP-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=C(C=C1)C(=O)C)O)C |
Computed by PubChem (NCBI)