CAS 537017-56-4 is the registry number for ([5-(4-Chlorophenyl)-4-(2-furylmethyl)-4h-1,2,4-triazol-3-yl]thio)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-[[5-(4-chlorophenyl)-4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid (CAS 537017-56-4) is a chemical compound with the molecular formula C15H12ClN3O3S and a molecular weight of 349.8 g/mol. IUPAC name: 2-[[5-(4-chlorophenyl)-4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid. InChIKey: GSUHRTPRFGKPIZ-UHFFFAOYSA-N.
| Molecular formula | C15H12ClN3O3S |
|---|---|
| Molecular weight | 349.8 g/mol |
| IUPAC name | 2-[[5-(4-chlorophenyl)-4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| InChIKey | GSUHRTPRFGKPIZ-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)CN2C(=NN=C2SCC(=O)O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)