CAS 893725-74-1 is the registry number for 2-{(5-(3-chlorophenyl)-4-(furan-2-ylmethyl)-4H-1,2,4-triazol-3-yl)sulfanyl}acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-[[5-(3-chlorophenyl)-4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid (CAS 893725-74-1) is a chemical compound with the molecular formula C15H12ClN3O3S and a molecular weight of 349.8 g/mol. IUPAC name: 2-[[5-(3-chlorophenyl)-4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid. InChIKey: GBTRCFQHWDEMRC-UHFFFAOYSA-N.
| Molecular formula | C15H12ClN3O3S |
|---|---|
| Molecular weight | 349.8 g/mol |
| IUPAC name | 2-[[5-(3-chlorophenyl)-4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| InChIKey | GBTRCFQHWDEMRC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NN=C(N2CC3=CC=CO3)SCC(=O)O |
Computed by PubChem (NCBI)