Products 53734-74-0
CAS 53734-74-0 appears in our catalog under these names: Neorauflavane, Neorauflavane, 96.0%, Neorauflavane, 97.0%. Offered by: GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 1 mg.
4-[(7R)-5-methoxy-2,2-dimethyl-7,8-dihydro-6H-pyrano[3,2-g]chromen-7-yl]benzene-1,3-diol (CAS 53734-74-0) is a chemical compound with the molecular formula C21H22O5 and a molecular weight of 354.4 g/mol. IUPAC name: 4-[(7R)-5-methoxy-2,2-dimethyl-7,8-dihydro-6H-pyrano[3,2-g]chromen-7-yl]benzene-1,3-diol. InChIKey: FLKVRTIAGSMQLN-LBPRGKRZSA-N.
| Molecular formula | C21H22O5 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | 4-[(7R)-5-methoxy-2,2-dimethyl-7,8-dihydro-6H-pyrano[3,2-g]chromen-7-yl]benzene-1,3-diol |
| InChIKey | FLKVRTIAGSMQLN-LBPRGKRZSA-N |
| SMILES | CC1(C=CC2=C(O1)C=C3C(=C2OC)C[C@@H](CO3)C4=C(C=C(C=C4)O)O)C |
Computed by PubChem (NCBI)
Synonyms:
Neorauflavane, orb1682028