CAS 53753-37-0 appears in our catalog under these names: Diethyl (nitromethyl)phosphonate, Diethyl (Nitromethyl)phosphonate, ≥95%, ≥95%, DIETHYL (NITROMETHYL)PHOSPHONATE, ≥95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g.
1-[ethoxy(nitromethyl)phosphoryl]oxyethane (CAS 53753-37-0) is a chemical compound with the molecular formula C5H12NO5P and a molecular weight of 197.13 g/mol. IUPAC name: 1-[ethoxy(nitromethyl)phosphoryl]oxyethane. InChIKey: UPZUEDDBUDQFQB-UHFFFAOYSA-N.
| Molecular formula | C5H12NO5P |
|---|---|
| Molecular weight | 197.13 g/mol |
| IUPAC name | 1-[ethoxy(nitromethyl)phosphoryl]oxyethane |
| InChIKey | UPZUEDDBUDQFQB-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(C[N+](=O)[O-])OCC |
Computed by PubChem (NCBI)