Products 53755-03-6
CAS 53755-03-6 is the registry number for cis-Clovamide. Offered by: MedChemExpress. Available pack sizes: 5mg, 25mg, 10mg.
(2S)-3-(3,4-dihydroxyphenyl)-2-[[(Z)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]propanoic acid (CAS 53755-03-6) is a chemical compound with the molecular formula C18H17NO7 and a molecular weight of 359.3 g/mol. IUPAC name: (2S)-3-(3,4-dihydroxyphenyl)-2-[[(Z)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]propanoic acid. InChIKey: GPZFXSWMDFBRGS-RYBZSIHZSA-N.
| Molecular formula | C18H17NO7 |
|---|---|
| Molecular weight | 359.3 g/mol |
| IUPAC name | (2S)-3-(3,4-dihydroxyphenyl)-2-[[(Z)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]propanoic acid |
| InChIKey | GPZFXSWMDFBRGS-RYBZSIHZSA-N |
| SMILES | C1=CC(=C(C=C1C[C@@H](C(=O)O)NC(=O)/C=C\C2=CC(=C(C=C2)O)O)O)O |
Computed by PubChem (NCBI)