CAS 5378-35-8 appears in our catalog under these names: 3-(1,3,4-Oxadiazol-2-yl)aniline, 95%, 3-(1,3,4-Oxadiazol-2-yl)aniline. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 1g, 0,5g, 5g.
3-(1,3,4-oxadiazol-2-yl)aniline (CAS 5378-35-8) is a chemical compound with the molecular formula C8H7N3O and a molecular weight of 161.16 g/mol. IUPAC name: 3-(1,3,4-oxadiazol-2-yl)aniline. InChIKey: BNGIMWCROMYOKW-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 3-(1,3,4-oxadiazol-2-yl)aniline |
| InChIKey | BNGIMWCROMYOKW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=NN=CO2 |
Computed by PubChem (NCBI)