CAS 53786-44-0 appears in our catalog under these names: Domperidone Impurity 2, Domperidone Impurity 11, Domperidone Impurity 8, Ethyl 4-[(4-chloro-2-nitrophenyl)amino]-1-piperidinecarboxylate. Offered by: Chemat Brand, Hubei YoungXin, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1g.
Ethyl 4-(4-chloro-2-nitroanilino)piperidine-1-carboxylate (CAS 53786-44-0) is a chemical compound with the molecular formula C14H18ClN3O4 and a molecular weight of 327.76 g/mol. IUPAC name: ethyl 4-(4-chloro-2-nitroanilino)piperidine-1-carboxylate. InChIKey: GMDPPHXPURQLKC-UHFFFAOYSA-N.
| Molecular formula | C14H18ClN3O4 |
|---|---|
| Molecular weight | 327.76 g/mol |
| IUPAC name | ethyl 4-(4-chloro-2-nitroanilino)piperidine-1-carboxylate |
| InChIKey | GMDPPHXPURQLKC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1CCC(CC1)NC2=C(C=C(C=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)