CAS 85076-03-5 is the registry number for Domperidone Impurity 35. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 4-(5-chloro-2-nitroanilino)piperidine-1-carboxylate (CAS 85076-03-5) is a chemical compound with the molecular formula C14H18ClN3O4 and a molecular weight of 327.76 g/mol. IUPAC name: ethyl 4-(5-chloro-2-nitroanilino)piperidine-1-carboxylate. InChIKey: TYZPQQYEGVWDNR-UHFFFAOYSA-N.
| Molecular formula | C14H18ClN3O4 |
|---|---|
| Molecular weight | 327.76 g/mol |
| IUPAC name | ethyl 4-(5-chloro-2-nitroanilino)piperidine-1-carboxylate |
| InChIKey | TYZPQQYEGVWDNR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1CCC(CC1)NC2=C(C=CC(=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)