CAS 5388-42-1 appears in our catalog under these names: 2-Phenylisoindolin-1-one 95%, 2-PHENYLISOINDOLIN-1-ONE, 98%, 2-Phenylisoindolin-1-one, 98%, 98%, 2,3-Dihydro-2-phenyl-1h-isoindol-1-oxo-isoindoline, 95%. Offered by: Ambeed, Fluorochem, Chemat, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-phenyl-3H-isoindol-1-one (CAS 5388-42-1) is a chemical compound with the molecular formula C14H11NO and a molecular weight of 209.24 g/mol. IUPAC name: 2-phenyl-3H-isoindol-1-one. InChIKey: FIWLYGQHSKZFAQ-UHFFFAOYSA-N.
| Molecular formula | C14H11NO |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | 2-phenyl-3H-isoindol-1-one |
| InChIKey | FIWLYGQHSKZFAQ-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C(=O)N1C3=CC=CC=C3 |
Computed by PubChem (NCBI)