CAS 53885-35-1 appears in our catalog under these names: Ticlopidine Hydrochloride, >95% (HPLC), Ticlopidine Hydrochloride, Ticlopidine hydrochloride/ 99.82% (existing batch purity), Ticlopidine hydrochloride, Ticlopidine HCl - Bio-X â„¢. Offered by: TRC, Mikromol, LoGiCal, TargetMol, GLPBio. Available pack sizes: 100g, 1g, 25g, 250mg, 10mg, 200mg, 5g, 100mg.
5-[(2-chlorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine;hydrochloride (CAS 53885-35-1) is a chemical compound with the molecular formula C14H15Cl2NS and a molecular weight of 300.2 g/mol. IUPAC name: 5-[(2-chlorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine;hydrochloride. InChIKey: MTKNGOHFNXIVOS-UHFFFAOYSA-N.
| Molecular formula | C14H15Cl2NS |
|---|---|
| Molecular weight | 300.2 g/mol |
| IUPAC name | 5-[(2-chlorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine;hydrochloride |
| InChIKey | MTKNGOHFNXIVOS-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C1SC=C2)CC3=CC=CC=C3Cl.Cl |
Computed by PubChem (NCBI)