CAS 53885-39-5 is the registry number for Ticlopidine EP Impurity H (as Hydrochloride). Offered by: Mikromol. Available pack sizes: 25mg.
5-[(4-chlorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine;hydrochloride (CAS 53885-39-5) is a chemical compound with the molecular formula C14H15Cl2NS and a molecular weight of 300.2 g/mol. IUPAC name: 5-[(4-chlorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine;hydrochloride. InChIKey: JYQUHDDZMJEWDY-UHFFFAOYSA-N.
| Molecular formula | C14H15Cl2NS |
|---|---|
| Molecular weight | 300.2 g/mol |
| IUPAC name | 5-[(4-chlorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine;hydrochloride |
| InChIKey | JYQUHDDZMJEWDY-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C1SC=C2)CC3=CC=C(C=C3)Cl.Cl |
Computed by PubChem (NCBI)