CAS 53907-55-4 appears in our catalog under these names: Isonicotinic Acid-d4, >95% (HPLC), Isonicotinic-d4 Acid, 98 atom % D, min 98% Chemical Purity, Isonicotinic acid-d4, 98.12%. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 250mg, 25mg, 0,5g, 0,1g, 10 mg, 5 mg, 25 mg, 1 mg.
2,3,5,6-tetradeuteriopyridine-4-carboxylic acid (CAS 53907-55-4) is a chemical compound with the molecular formula C6H5NO2 and a molecular weight of 127.13 g/mol. IUPAC name: 2,3,5,6-tetradeuteriopyridine-4-carboxylic acid. InChIKey: TWBYWOBDOCUKOW-RHQRLBAQSA-N.
| Molecular formula | C6H5NO2 |
|---|---|
| Molecular weight | 127.13 g/mol |
| IUPAC name | 2,3,5,6-tetradeuteriopyridine-4-carboxylic acid |
| InChIKey | TWBYWOBDOCUKOW-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(N=C(C(=C1C(=O)O)[2H])[2H])[2H] |
Computed by PubChem (NCBI)