CAS 53912-80-4 appears in our catalog under these names: (S)–1–N–Benzyl–prolinol, (S)-1-N-Benzyl-prolinol 97%, (S)-(-)-1-BENZYL-2-PYRROLIDINEMETHANOL,&, (S)-1-N-Benzyl-prolinol, 97%, 97%, (S)-1-N-Benzyl-prolinol, 97%. Offered by: GLPBio, Ambeed, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 500g, 1g, 5g, 10g.
[(2S)-1-benzylpyrrolidin-2-yl]methanol (CAS 53912-80-4) is a chemical compound with the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. IUPAC name: [(2S)-1-benzylpyrrolidin-2-yl]methanol. InChIKey: ZAIQBJPTOXDDKA-LBPRGKRZSA-N.
| Molecular formula | C12H17NO |
|---|---|
| Molecular weight | 191.27 g/mol |
| IUPAC name | [(2S)-1-benzylpyrrolidin-2-yl]methanol |
| InChIKey | ZAIQBJPTOXDDKA-LBPRGKRZSA-N |
| SMILES | C1C[C@H](N(C1)CC2=CC=CC=C2)CO |
Computed by PubChem (NCBI)