CAS 53936-56-4 appears in our catalog under these names: Deoxyarbutin, >95% (HPLC), Deoxyarbutin, Deoxyarbutin/ 99.94% (existing batch purity), Deoxyarbutin 98%, 4-(Tetrahydro-2H-pyran-2-yloxy)phenol, 98%, 98%. Offered by: TRC, Dr. Ehrenstorfer, TargetMol, GLPBio, Biosynth. Available pack sizes: 50mg, 250mg, 500mg, 10mM (in 1ml dmso), 25g, 50g, 5g, 100g.
4-(oxan-2-yloxy)phenol (CAS 53936-56-4) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: 4-(oxan-2-yloxy)phenol. InChIKey: GFBCWCDNXDKFRH-UHFFFAOYSA-N.
| Molecular formula | C11H14O3 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 4-(oxan-2-yloxy)phenol |
| InChIKey | GFBCWCDNXDKFRH-UHFFFAOYSA-N |
| SMILES | C1CCOC(C1)OC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)