Products 53976-65-1
CAS 53976-65-1 appears in our catalog under these names: 2,3-Dichloropyridine 1-oxide, 95%, 2，3–Dichloropyridine1–oxide, 2,3-Dichloropyridine1-oxide 95%, 2,3-Dichloropyridine1-oxide, 95%, 95%. Offered by: Fluorochem, GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,3-dichloro-1-oxidopyridin-1-ium (CAS 53976-65-1) is a chemical compound with the molecular formula C5H3Cl2NO and a molecular weight of 163.99 g/mol. IUPAC name: 2,3-dichloro-1-oxidopyridin-1-ium. InChIKey: MPKISXFIMCWMLP-UHFFFAOYSA-N.
| Molecular formula | C5H3Cl2NO |
|---|---|
| Molecular weight | 163.99 g/mol |
| IUPAC name | 2,3-dichloro-1-oxidopyridin-1-ium |
| InChIKey | MPKISXFIMCWMLP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C([N+](=C1)[O-])Cl)Cl |
Computed by PubChem (NCBI)