CAS 5399-03-1 appears in our catalog under these names: 2-Iodo-1-methoxy-4-nitrobenzene 95%, 2-Iodo-4-ntiroanisole, 98%, 2-Iodo-1-methoxy-4-nitrobenzene, 95%, 95%, 2-Iodo-4-nitroanisole, 95%. Offered by: Ambeed, Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 100g, 1g, 10g.
2-iodo-1-methoxy-4-nitrobenzene (CAS 5399-03-1) is a chemical compound with the molecular formula C7H6INO3 and a molecular weight of 279.03 g/mol. IUPAC name: 2-iodo-1-methoxy-4-nitrobenzene. InChIKey: KBQBNJHOTNIGDD-UHFFFAOYSA-N.
| Molecular formula | C7H6INO3 |
|---|---|
| Molecular weight | 279.03 g/mol |
| IUPAC name | 2-iodo-1-methoxy-4-nitrobenzene |
| InChIKey | KBQBNJHOTNIGDD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)[N+](=O)[O-])I |
Computed by PubChem (NCBI)