CAS 725266-66-0 appears in our catalog under these names: 3-Iodo-2-nitroanisole, 98%, 1–Iodo–3–methoxy–2–nitrobenzene, 1-Iodo-3-methoxy-2-nitrobenzene 98%, 1-Iodo-3-methoxy-2-nitrobenzene, 98%, 98%, 1-IODO-3-METHOXY-2-NITROBENZENE,3-IODO-2-NITROPHENYL METHYL ETHER, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 25g, 1g, 5g, 100mg.
1-iodo-3-methoxy-2-nitrobenzene (CAS 725266-66-0) is a chemical compound with the molecular formula C7H6INO3 and a molecular weight of 279.03 g/mol. IUPAC name: 1-iodo-3-methoxy-2-nitrobenzene. InChIKey: RINUUFLGNUBQLM-UHFFFAOYSA-N.
| Molecular formula | C7H6INO3 |
|---|---|
| Molecular weight | 279.03 g/mol |
| IUPAC name | 1-iodo-3-methoxy-2-nitrobenzene |
| InChIKey | RINUUFLGNUBQLM-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC=C1)I)[N+](=O)[O-] |
Computed by PubChem (NCBI)