CAS 5405-66-3 appears in our catalog under these names: 6,6-Dimethyl-n2-phenyl-1,6-dihydro-1,3,5-triazine-2,4-diamine, 95%, 6,6-DIMETHYL-N~2~-PHENYL-1,6-DIHYDRO-1,3,5-TRIAZINE-2,4-DIAMINE, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
4,4-dimethyl-2-N-phenyl-1H-1,3,5-triazine-2,6-diamine (CAS 5405-66-3) is a chemical compound with the molecular formula C11H15N5 and a molecular weight of 217.27 g/mol. IUPAC name: 4,4-dimethyl-2-N-phenyl-1H-1,3,5-triazine-2,6-diamine. InChIKey: JPHQETJAWFRRBM-UHFFFAOYSA-N.
| Molecular formula | C11H15N5 |
|---|---|
| Molecular weight | 217.27 g/mol |
| IUPAC name | 4,4-dimethyl-2-N-phenyl-1H-1,3,5-triazine-2,6-diamine |
| InChIKey | JPHQETJAWFRRBM-UHFFFAOYSA-N |
| SMILES | CC1(N=C(NC(=N1)NC2=CC=CC=C2)N)C |
Computed by PubChem (NCBI)