Products 862368-63-6
CAS 862368-63-6 appears in our catalog under these names: 3-tert-Butyl-1-(pyrimidin-2-yl)-1h-pyrazol-5-amine, 95%, 3-tert-Butyl-1-(pyrimidin-2-yl)-1H-pyrazol-5-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
3-tert-butyl-1-pyrimidin-2-ylpyrazol-5-amine (CAS 862368-63-6) is a chemical compound with the molecular formula C11H15N5 and a molecular weight of 217.27 g/mol. IUPAC name: 3-tert-butyl-1-pyrimidin-2-ylpyrazol-5-amine. InChIKey: MTKDCIMCMVHWMT-UHFFFAOYSA-N.
| Molecular formula | C11H15N5 |
|---|---|
| Molecular weight | 217.27 g/mol |
| IUPAC name | 3-tert-butyl-1-pyrimidin-2-ylpyrazol-5-amine |
| InChIKey | MTKDCIMCMVHWMT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NN(C(=C1)N)C2=NC=CC=N2 |
Computed by PubChem (NCBI)