CAS 541-64-0 is the registry number for 1-(Furan-2-yl)-N,N,N-trimethylmethanaminium iodide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Furan-2-ylmethyl(trimethyl)azanium iodide (CAS 541-64-0) is a chemical compound with the molecular formula C8H14INO and a molecular weight of 267.11 g/mol. IUPAC name: furan-2-ylmethyl(trimethyl)azanium iodide. InChIKey: YKASHPSKFYVZRC-UHFFFAOYSA-M.
| Molecular formula | C8H14INO |
|---|---|
| Molecular weight | 267.11 g/mol |
| IUPAC name | furan-2-ylmethyl(trimethyl)azanium iodide |
| InChIKey | YKASHPSKFYVZRC-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)CC1=CC=CO1.[I-] |
Computed by PubChem (NCBI)