Products 541-64-0

CAS 541-64-0 is the registry number for 1-(Furan-2-yl)-N,N,N-trimethylmethanaminium iodide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Furan-2-ylmethyl(trimethyl)azanium iodide (CAS 541-64-0) is a chemical compound with the molecular formula C8H14INO and a molecular weight of 267.11 g/mol. IUPAC name: furan-2-ylmethyl(trimethyl)azanium iodide. InChIKey: YKASHPSKFYVZRC-UHFFFAOYSA-M.

Identity
Molecular formulaC8H14INO
Molecular weight267.11 g/mol
IUPAC namefuran-2-ylmethyl(trimethyl)azanium iodide
InChIKeyYKASHPSKFYVZRC-UHFFFAOYSA-M
SMILESC[N+](C)(C)CC1=CC=CO1.[I-]

Computed by PubChem (NCBI)