CAS 6659-51-4 is the registry number for 3-Oxo-1-methylquinuclidinium iodide. Offered by: Biosynth. Available pack sizes: 100mg, 50mg.
1-methyl-1-azoniabicyclo[2.2.2]octan-3-one iodide (CAS 6659-51-4) is a chemical compound with the molecular formula C8H14INO and a molecular weight of 267.11 g/mol. IUPAC name: 1-methyl-1-azoniabicyclo[2.2.2]octan-3-one iodide. InChIKey: SVZAZASMEQJJMZ-UHFFFAOYSA-M.
| Molecular formula | C8H14INO |
|---|---|
| Molecular weight | 267.11 g/mol |
| IUPAC name | 1-methyl-1-azoniabicyclo[2.2.2]octan-3-one iodide |
| InChIKey | SVZAZASMEQJJMZ-UHFFFAOYSA-M |
| SMILES | C[N+]12CCC(CC1)C(=O)C2.[I-] |
Computed by PubChem (NCBI)