Products 541539-79-1
CAS 541539-79-1 is the registry number for 5-(Trifluoromethyl)-2,1,3-benzoxadiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
5-(trifluoromethyl)-2,1,3-benzoxadiazole (CAS 541539-79-1) is a chemical compound with the molecular formula C7H3F3N2O and a molecular weight of 188.11 g/mol. IUPAC name: 5-(trifluoromethyl)-2,1,3-benzoxadiazole. InChIKey: NPNSLWNYSKEJOT-UHFFFAOYSA-N.
| Molecular formula | C7H3F3N2O |
|---|---|
| Molecular weight | 188.11 g/mol |
| IUPAC name | 5-(trifluoromethyl)-2,1,3-benzoxadiazole |
| InChIKey | NPNSLWNYSKEJOT-UHFFFAOYSA-N |
| SMILES | C1=CC2=NON=C2C=C1C(F)(F)F |
Computed by PubChem (NCBI)