CAS 894406-63-4 appears in our catalog under these names: 2-(Trifluoromethyl)oxazolo[4,5-b]pyridine, 95%, 2-(Trifluoromethyl)oxazolo(4,5-b)pyridine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2-(trifluoromethyl)-[1,3]oxazolo[4,5-b]pyridine (CAS 894406-63-4) is a chemical compound with the molecular formula C7H3F3N2O and a molecular weight of 188.11 g/mol. IUPAC name: 2-(trifluoromethyl)-[1,3]oxazolo[4,5-b]pyridine. InChIKey: MJILPMZYOJELAX-UHFFFAOYSA-N.
| Molecular formula | C7H3F3N2O |
|---|---|
| Molecular weight | 188.11 g/mol |
| IUPAC name | 2-(trifluoromethyl)-[1,3]oxazolo[4,5-b]pyridine |
| InChIKey | MJILPMZYOJELAX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(N=C1)N=C(O2)C(F)(F)F |
Computed by PubChem (NCBI)