CAS 54221-54-4 is the registry number for 2,4-Dimethyl-5-phenylimidazo(1,5-b)pyridazine-7-thiol. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2,4-dimethyl-5-phenyl-6H-imidazo[1,5-b]pyridazine-7-thione (CAS 54221-54-4) is a chemical compound with the molecular formula C14H13N3S and a molecular weight of 255.34 g/mol. IUPAC name: 2,4-dimethyl-5-phenyl-6H-imidazo[1,5-b]pyridazine-7-thione. InChIKey: XCNWZKIENFVVGY-UHFFFAOYSA-N.
| Molecular formula | C14H13N3S |
|---|---|
| Molecular weight | 255.34 g/mol |
| IUPAC name | 2,4-dimethyl-5-phenyl-6H-imidazo[1,5-b]pyridazine-7-thione |
| InChIKey | XCNWZKIENFVVGY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN2C1=C(NC2=S)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)