CAS 849120-60-1 is the registry number for N-Benzyl-4-(1H-pyrrol-2-yl)thiazol-2-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-benzyl-4-(1H-pyrrol-2-yl)-1,3-thiazol-2-amine (CAS 849120-60-1) is a chemical compound with the molecular formula C14H13N3S and a molecular weight of 255.34 g/mol. IUPAC name: N-benzyl-4-(1H-pyrrol-2-yl)-1,3-thiazol-2-amine. InChIKey: ZFLCLFKWDZDTML-UHFFFAOYSA-N.
| Molecular formula | C14H13N3S |
|---|---|
| Molecular weight | 255.34 g/mol |
| IUPAC name | N-benzyl-4-(1H-pyrrol-2-yl)-1,3-thiazol-2-amine |
| InChIKey | ZFLCLFKWDZDTML-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=NC(=CS2)C3=CC=CN3 |
Computed by PubChem (NCBI)