Products 54239-39-3
CAS 54239-39-3 appears in our catalog under these names: Cimbuterol, >95% (HPLC), Cimbuterol, Cimbuterol, Concentration: 100 µg/ml Solvent: Methanol, Cimbuterol (Standard), Cimbuterol, 99.85%. Offered by: TRC, Dr. Ehrenstorfer, GLPBio, Sigma-Aldrich, Chemat. Available pack sizes: 100mg, 10mg, 25mg, 5mg, 50mg, 1x1ml, 1x10mg, Get quote.
2-amino-5-[2-(tert-butylamino)-1-hydroxyethyl]benzonitrile (CAS 54239-39-3) is a chemical compound with the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. IUPAC name: 2-amino-5-[2-(tert-butylamino)-1-hydroxyethyl]benzonitrile. InChIKey: YKKQAXQGZIBJFS-UHFFFAOYSA-N.
| Molecular formula | C13H19N3O |
|---|---|
| Molecular weight | 233.31 g/mol |
| IUPAC name | 2-amino-5-[2-(tert-butylamino)-1-hydroxyethyl]benzonitrile |
| InChIKey | YKKQAXQGZIBJFS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC(C1=CC(=C(C=C1)N)C#N)O |
Computed by PubChem (NCBI)