Products 54258-41-2
CAS 54258-41-2 appears in our catalog under these names: 1,10-Phenanthrolin-5-amine, 1,10–Phenanthrolin–5–amine, (1,10)Phenanthrolin-5-ylamine, 5-Amino-1,10-phenanthroline, >98.0%(GC), 1,10-Phenanthrolin-5-amine 98%. Offered by: TRC, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 1g, 50g, 5g, 25g, 500mg, 1000mg, 2000mg, 5000mg.
1,10-phenanthrolin-5-amine (CAS 54258-41-2) is a chemical compound with the molecular formula C12H9N3 and a molecular weight of 195.22 g/mol. IUPAC name: 1,10-phenanthrolin-5-amine. InChIKey: DKPSSMOJHLISJI-UHFFFAOYSA-N.
| Molecular formula | C12H9N3 |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | 1,10-phenanthrolin-5-amine |
| InChIKey | DKPSSMOJHLISJI-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=C3C=CC=NC3=C2N=C1)N |
Computed by PubChem (NCBI)