Products 54267-53-7

CAS 54267-53-7 is the registry number for 2-Bromopyridine-15N. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 5 mg, 50 mg.

Structural formula: {0} (CAS {1})

2-bromo(115N)pyridine (CAS 54267-53-7) is a chemical compound with the molecular formula C5H4BrN and a molecular weight of 158.99 g/mol. IUPAC name: 2-bromo(115N)pyridine. InChIKey: IMRWILPUOVGIMU-CDYZYAPPSA-N.

Identity
Molecular formulaC5H4BrN
Molecular weight158.99 g/mol
IUPAC name2-bromo(115N)pyridine
InChIKeyIMRWILPUOVGIMU-CDYZYAPPSA-N
SMILESC1=CC=[15N]C(=C1)Br

Computed by PubChem (NCBI)