CAS 66148-14-9 appears in our catalog under these names: 3-Bromopyridine-d4, 3-Bromopyridine-d4, 98 atom % D, min 98% Chemical Purity, 3–bromopyridine–2,4,5,6–d4. Offered by: TRC, CDN, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 100mg, 25mg, 50mg, 0,5g, 0,25g, 5mg, 1g, 50 mg.
3-bromo-2,4,5,6-tetradeuteriopyridine (CAS 66148-14-9) is a chemical compound with the molecular formula C5H4BrN and a molecular weight of 162.02 g/mol. IUPAC name: 3-bromo-2,4,5,6-tetradeuteriopyridine. InChIKey: NYPYPOZNGOXYSU-RHQRLBAQSA-N.
| Molecular formula | C5H4BrN |
|---|---|
| Molecular weight | 162.02 g/mol |
| IUPAC name | 3-bromo-2,4,5,6-tetradeuteriopyridine |
| InChIKey | NYPYPOZNGOXYSU-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(N=C1[2H])[2H])Br)[2H] |
Computed by PubChem (NCBI)